CAS 1190316-42-7
:7-Fluoro-4-methylbenzothiazole
Description:
7-Fluoro-4-methylbenzothiazole is a heterocyclic organic compound characterized by the presence of a benzothiazole ring, which consists of a fused benzene and thiazole moiety. The compound features a fluorine atom at the 7-position and a methyl group at the 4-position of the benzothiazole structure, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its reactivity, making it of interest in medicinal chemistry and material science. Benzothiazole derivatives are often studied for their biological activities, including antimicrobial and anticancer properties. The compound's specific reactivity and interactions can vary based on its substituents and the surrounding environment, making it a subject of interest for further research in synthetic and pharmaceutical chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H6FNS
InChI:InChI=1S/C8H6FNS/c1-5-2-3-6(9)8-7(5)10-4-11-8/h2-4H,1H3
InChI key:InChIKey=HUIOUKHDYJWMQP-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(F)C=C1)SC=N2
Synonyms:- 7-Fluoro-4-methylbenzothiazole
- Benzothiazole, 7-fluoro-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
