CymitQuimica logo

CAS 1190316-46-1

:

Methyl 4-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate

Description:
Methyl 4-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a pyridine and pyrrole moiety. This compound features a nitro group and a carboxylate ester, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the methyl groups enhances its lipophilicity, which may influence its biological activity and solubility properties. The nitro group is known for its electron-withdrawing effects, which can affect the compound's reactivity in various chemical reactions. Methyl esters like this one are often used as intermediates in the synthesis of pharmaceuticals and agrochemicals. Additionally, the specific arrangement of substituents on the pyrrolo-pyridine framework may impart unique pharmacological properties, making it a subject of interest in drug discovery. Overall, this compound exemplifies the diverse chemistry of nitrogen-containing heterocycles and their significance in various fields of research.
Formula:C10H9N3O4
InChI:InChI=1S/C10H9N3O4/c1-5-6(10(14)17-2)3-11-9-8(5)7(4-12-9)13(15)16/h3-4H,1-2H3,(H,11,12)
InChI key:InChIKey=KYVYJGJWOZKAQP-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(=NC=C(C(OC)=O)C2C)NC1
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 4-methyl-3-nitro-, methyl ester
  • Methyl 4-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.