CymitQuimica logo

CAS 1190316-52-9

:

3-Bromo-6-fluoro-1H-pyrrolo[3,2-c]pyridine

Description:
3-Bromo-6-fluoro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and fluorine substituents enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate to high polarity due to the electronegative halogen atoms, influencing its solubility in various solvents. Its structure may allow for diverse interactions with biological targets, making it of interest in drug discovery. Additionally, the compound's stability can be affected by the presence of the halogens, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, 3-Bromo-6-fluoro-1H-pyrrolo[3,2-c]pyridine is a valuable compound in synthetic organic chemistry, with potential applications in pharmaceuticals and agrochemicals, owing to its unique structural features and reactivity profile.
Formula:C7H4BrFN2
InChI:InChI=1S/C7H4BrFN2/c8-5-3-10-6-1-7(9)11-2-4(5)6/h1-3,10H
InChI key:InChIKey=IYSLZBZCYCYBHH-UHFFFAOYSA-N
SMILES:BrC=1C=2C(NC1)=CC(F)=NC2
Synonyms:
  • 3-Bromo-6-fluoro-1H-pyrrolo[3,2-c]pyridine
  • 1H-Pyrrolo[3,2-c]pyridine, 3-bromo-6-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.