CAS 1190316-60-9

6-Fluoro-3-iodo-1H-pyrrolo[3,2-c]pyridine

Description:

6-Fluoro-3-iodo-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. The presence of fluorine and iodine substituents at the 6 and 3 positions, respectively, significantly influences its chemical reactivity and physical properties. This compound typically exhibits a high degree of lipophilicity due to the halogen atoms, which can enhance its biological activity and potential as a pharmaceutical agent. It may also display interesting electronic properties owing to the electron-withdrawing nature of the halogens. The compound is likely to be soluble in organic solvents and may have moderate stability under standard laboratory conditions. Its unique structure and substituents make it a candidate for various applications in medicinal chemistry, particularly in the development of novel therapeutic agents targeting specific biological pathways. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental concerns associated with halogenated organic substances.

Formula: C₇H₄FIN₂

InChI: InChI=1S/C7H4FIN2/c8-7-1-6-4(2-11-7)5(9)3-10-6/h1-3,10H

InChI key: InChIKey=IFWNXNDBSJKYKZ-UHFFFAOYSA-N

SMILES: IC=1C=2C(NC1)=CC(F)=NC2

Synonyms:

• 1H-Pyrrolo[3,2-c]pyridine, 6-fluoro-3-iodo-
• 6-Fluoro-3-iodo-1H-pyrrolo[3,2-c]pyridine

6-fluoro-3-iodo-1H-pyrrolo[3,2-c]pyridine

CAS: 1190316-60-9

Formula: C₇H₄FIN₂

Molecular weight: 262.0229

Ref: IN-DA000HQ2