
CAS 1190316-72-3
:3-Iodo-4-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid
Description:
3-Iodo-4-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid is a heterocyclic compound characterized by its unique pyrrolopyridine structure, which incorporates both a pyrrole and a pyridine ring. The presence of an iodine atom at the 3-position and a methyl group at the 4-position contributes to its distinct chemical properties and reactivity. This compound features a carboxylic acid functional group at the 5-position, which enhances its acidity and potential for forming hydrogen bonds. The molecular structure allows for various interactions, making it of interest in medicinal chemistry and drug development. Its iodine substituent may also impart specific biological activities or enhance lipophilicity, influencing its pharmacokinetic properties. Additionally, the compound's solubility and stability can be affected by the presence of the carboxylic acid group, which can participate in various chemical reactions, including esterification and amidation. Overall, 3-Iodo-4-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C9H7IN2O2
InChI:InChI=1S/C9H7IN2O2/c1-4-5(9(13)14)2-11-8-7(4)6(10)3-12-8/h2-3H,1H3,(H,11,12)(H,13,14)
InChI key:InChIKey=FAIXDYNBARIGDD-UHFFFAOYSA-N
SMILES:CC1=C2C(=NC=C1C(O)=O)NC=C2I
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 3-iodo-4-methyl-
- 3-Iodo-4-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 3-iodo-4-methyl-
CAS:Formula:C9H7IN2O2Molecular weight:302.0685
