CAS 1190316-83-6

3-Chloro-7-methoxy-1H-pyrrolo[2,3-c]pyridine

Description:

3-Chloro-7-methoxy-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. The presence of a chlorine atom at the 3-position and a methoxy group at the 7-position contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. The chlorine and methoxy substituents can influence the compound's electronic properties, potentially affecting its interaction with biological targets. Additionally, the compound may undergo various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₈H₇ClN₂O

InChI: InChI=1S/C8H7ClN2O/c1-12-8-7-5(2-3-10-8)6(9)4-11-7/h2-4,11H,1H3

InChI key: InChIKey=XBTDAPOGPNACHX-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(C(Cl)=CN2)=CC=N1

Synonyms:

• 3-Chloro-7-methoxy-1H-pyrrolo[2,3-c]pyridine
• 1H-Pyrrolo[2,3-c]pyridine, 3-chloro-7-methoxy-

1H-Pyrrolo[2,3-c]pyridine, 3-chloro-7-methoxy-

CAS: 1190316-83-6

Formula: C₈H₇ClN₂O

Molecular weight: 182.607

Ref: IN-DA000HPP