
CAS 1190316-89-2
:3-Chloro-1H-pyrrolo[3,2-b]pyridin-6-ol
Description:
3-Chloro-1H-pyrrolo[3,2-b]pyridin-6-ol is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. The presence of a chlorine atom at the 3-position and a hydroxyl group at the 6-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their biological properties. The chlorine substituent can influence the compound's electronic properties and reactivity, making it a candidate for further chemical modifications. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 3-Chloro-1H-pyrrolo[3,2-b]pyridin-6-ol represents a class of compounds of interest in both synthetic and medicinal chemistry.
Formula:C7H5ClN2O
InChI:InChI=1S/C7H5ClN2O/c8-5-3-9-6-1-4(11)2-10-7(5)6/h1-3,9,11H
InChI key:InChIKey=JEGKMXTZIDRFNF-UHFFFAOYSA-N
SMILES:ClC=1C=2C(NC1)=CC(O)=CN2
Synonyms:- 1H-Pyrrolo[3,2-b]pyridin-6-ol, 3-chloro-
- 3-Chloro-1H-pyrrolo[3,2-b]pyridin-6-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
