CymitQuimica logo

CAS 1190316-93-8

:

5-Bromo-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Description:
5-Bromo-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyrrole and pyridine rings. The presence of a bromine atom at the 5-position and a methyl group at the 4-position contributes to its unique reactivity and potential biological activity. This compound features a carboxylic acid functional group at the 3-position, which enhances its solubility in polar solvents and may influence its interaction with biological targets. It is typically used in medicinal chemistry and research due to its potential as a building block for pharmaceuticals or as a ligand in coordination chemistry. The compound's molecular structure allows for various substitution reactions, making it versatile in synthetic applications. Additionally, its properties may include moderate stability under standard conditions, but it may be sensitive to strong acids or bases. Overall, 5-Bromo-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is of interest for its chemical reactivity and potential applications in drug development.
Formula:C9H7BrN2O2
InChI:InChI=1S/C9H7BrN2O2/c1-4-6(10)3-12-8-7(4)5(2-11-8)9(13)14/h2-3H,1H3,(H,11,12)(H,13,14)
InChI key:InChIKey=UVJAFTKUNRILOE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=NC=C(Br)C2C
Synonyms:
  • 5-Bromo-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
  • 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 5-bromo-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.