CymitQuimica logo

CAS 1190316-99-4

:

3-Iodo-1H-pyrrolo[3,2-b]pyridin-6-ol

Description:
3-Iodo-1H-pyrrolo[3,2-b]pyridin-6-ol is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. The presence of an iodine atom at the 3-position and a hydroxyl group at the 6-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group, while its iodine substituent can influence its electronic properties and reactivity. The compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as heterocycles often play crucial roles in pharmacologically active compounds. Additionally, the presence of the iodine atom may enhance its utility in various synthetic transformations, including coupling reactions and as a precursor for further functionalization. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of iodine, which can be hazardous in certain concentrations.
Formula:C7H5IN2O
InChI:InChI=1S/C7H5IN2O/c8-5-3-9-6-1-4(11)2-10-7(5)6/h1-3,9,11H
InChI key:InChIKey=WZHOOEZIUNJOSS-UHFFFAOYSA-N
SMILES:IC=1C=2C(NC1)=CC(O)=CN2
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridin-6-ol, 3-iodo-
  • 3-Iodo-1H-pyrrolo[3,2-b]pyridin-6-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.