
CAS 1190317-20-4
:6-Nitro-1H-pyrrolo[3,2-b]pyridine-3-carboxaldehyde
Description:
6-Nitro-1H-pyrrolo[3,2-b]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both a nitro group and an aldehyde functional group. The presence of the nitro group typically imparts increased reactivity, particularly in electrophilic substitution reactions. The aldehyde group allows for further functionalization, making it a versatile intermediate in organic synthesis. This compound is likely to exhibit moderate solubility in polar organic solvents due to its polar functional groups. Its unique structure may also confer specific biological activities, making it of interest in medicinal chemistry and drug development. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the nitro group and the aromatic nature of the pyridine ring. Overall, 6-Nitro-1H-pyrrolo[3,2-b]pyridine-3-carboxaldehyde serves as a valuable building block in the synthesis of more complex molecules in various chemical research applications.
Formula:C8H5N3O3
InChI:InChI=1S/C8H5N3O3/c12-4-5-2-9-7-1-6(11(13)14)3-10-8(5)7/h1-4,9H
InChI key:InChIKey=APPQLJFRQPEYTF-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(=CC(N(=O)=O)=CN2)NC1
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine-3-carboxaldehyde, 6-nitro-
- 6-Nitro-1H-pyrrolo[3,2-b]pyridine-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
