CAS 1190317-23-7

6-Nitro-1H-pyrrolo[3,2-b]pyridin-3-amine

Description:

6-Nitro-1H-pyrrolo[3,2-b]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrole and pyridine moiety. The presence of a nitro group at the 6-position contributes to its chemical reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in polar solvents and may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions due to the electron-withdrawing nature of the nitro group. Its structural features suggest potential biological activity, making it a candidate for further investigation in drug development. The compound's molecular framework allows for interactions with biological targets, which could lead to therapeutic applications. Additionally, the presence of amino groups can enhance its reactivity and solubility, influencing its pharmacokinetic properties. Overall, 6-Nitro-1H-pyrrolo[3,2-b]pyridin-3-amine represents a significant compound in the field of organic synthesis and medicinal chemistry.

Formula: C₇H₆N₄O₂

InChI: InChI=1S/C7H6N4O2/c8-5-3-9-6-1-4(11(12)13)2-10-7(5)6/h1-3,9H,8H2

InChI key: InChIKey=NDMZABIKCCKAKE-UHFFFAOYSA-N

SMILES: NC=1C=2C(=CC(N(=O)=O)=CN2)NC1

Synonyms:

• 6-Nitro-1H-pyrrolo[3,2-b]pyridin-3-amine
• 1H-Pyrrolo[3,2-b]pyridin-3-amine, 6-nitro-

1H-Pyrrolo[3,2-b]pyridin-3-amine, 6-nitro-

CAS: 1190317-23-7

Formula: C₇H₆N₄O₂

Molecular weight: 178.1481

Ref: IN-DA000HQH