CymitQuimica logo

CAS 1190317-34-0

:

4-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde

Description:
4-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a chloro substituent enhances its reactivity, making it useful in various synthetic applications. This compound features an aldehyde functional group, which is known for its reactivity in nucleophilic addition reactions, allowing it to participate in further chemical transformations. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. Additionally, the compound may exhibit interesting optical and electronic properties, making it a candidate for research in materials science. As with many heterocycles, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its practical applications in laboratory settings. Overall, 4-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde is a versatile compound with significant potential in various fields of chemistry.
Formula:C8H5ClN2O
InChI:InChI=1S/C8H5ClN2O/c9-8-7-5(4-12)3-11-6(7)1-2-10-8/h1-4,11H
InChI key:InChIKey=DIUVIQBVOYRQSM-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1)=CC=NC2Cl
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine-3-carboxaldehyde, 4-chloro-
  • 4-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.