CymitQuimica logo

CAS 1190317-35-1

:

5-Hydroxy-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde

Description:
5-Hydroxy-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine rings fused together, which contributes to its unique chemical properties. This compound features a hydroxyl group and an aldehyde functional group, making it a potential candidate for various chemical reactions, including oxidation and condensation. The presence of the hydroxyl group enhances its solubility in polar solvents, while the aldehyde group can participate in nucleophilic addition reactions. Its structural complexity allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological disorders, given the pyridine's role in biological systems. Additionally, the compound may exhibit interesting optical and electronic properties due to its conjugated system. As with many heterocycles, the stability and reactivity of 5-Hydroxy-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde can be influenced by substituents and environmental conditions, making it a subject of interest for further research in organic synthesis and drug development.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c11-4-5-2-9-8-7(5)1-6(12)3-10-8/h1-4,12H,(H,9,10)
InChI key:InChIKey=GNPLRSGYPRIBKT-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1)=NC=C(O)C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-3-carboxaldehyde, 5-hydroxy-
  • 5-Hydroxy-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.