CymitQuimica logo

CAS 1190317-37-3

:

3-Iodo-6-methoxy-1H-pyrrolo[2,3-b]pyridine

Description:
3-Iodo-6-methoxy-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both a pyrrole and a pyridine ring. The presence of an iodine atom at the 3-position and a methoxy group at the 6-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the iodine atom, which can enhance biological activity or facilitate further chemical modifications. Additionally, the methoxy group may influence the compound's electronic properties and steric hindrance, affecting its interactions with biological targets. As with many heterocycles, it may also exhibit interesting optical and electronic properties, making it a subject of interest in materials science and organic electronics.
Formula:C8H7IN2O
InChI:InChI=1S/C8H7IN2O/c1-12-7-3-2-5-6(9)4-10-8(5)11-7/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=IPEGQDHLWYOJHE-UHFFFAOYSA-N
SMILES:IC=1C=2C(=NC(OC)=CC2)NC1
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 3-iodo-6-methoxy-
  • 3-Iodo-6-methoxy-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.