CymitQuimica logo

CAS 1190317-60-2

:

6-Chloro-1H-pyrrolo[3,2-b]pyridin-3-amine

Description:
6-Chloro-1H-pyrrolo[3,2-b]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine moiety. The presence of a chlorine atom at the 6-position of the pyrrole ring contributes to its reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in polar solvents and stability under standard laboratory conditions. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and drug development. The amine functional group at the 3-position enhances its potential for forming hydrogen bonds, which can influence its interaction with biological targets. Additionally, compounds of this class may exhibit pharmacological properties, including anti-cancer or anti-inflammatory activities, although specific biological data would be necessary to confirm such effects. Overall, 6-Chloro-1H-pyrrolo[3,2-b]pyridin-3-amine represents a valuable scaffold for further research in synthetic and medicinal chemistry.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c8-4-1-6-7(11-2-4)5(9)3-10-6/h1-3,10H,9H2
InChI key:InChIKey=JYTOGRSXHXJAFO-UHFFFAOYSA-N
SMILES:NC=1C=2C(NC1)=CC(Cl)=CN2
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridin-3-amine, 6-chloro-
  • 6-Chloro-1H-pyrrolo[3,2-b]pyridin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.