
CAS 1190317-78-2
:7-Bromo-3-nitro-1H-pyrrolo[2,3-c]pyridine
Description:
7-Bromo-3-nitro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 7-position and a nitro group at the 3-position enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate solubility in organic solvents, and its structure allows for various substitution reactions, making it a valuable intermediate in the synthesis of more complex molecules. The nitro group can serve as a site for reduction reactions, while the bromine can participate in nucleophilic substitution reactions. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential pharmaceutical applications. Its molecular structure and functional groups suggest that it could interact with biological targets, making it of interest in drug discovery and development. Overall, 7-Bromo-3-nitro-1H-pyrrolo[2,3-c]pyridine is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C7H4BrN3O2
InChI:InChI=1S/C7H4BrN3O2/c8-7-6-4(1-2-9-7)5(3-10-6)11(12)13/h1-3,10H
InChI key:InChIKey=TYVWXIXPMLKSEL-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=C(Br)N=CC2
Synonyms:- 7-Bromo-3-nitro-1H-pyrrolo[2,3-c]pyridine
- 1H-Pyrrolo[2,3-c]pyridine, 7-bromo-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
