CAS 1190317-82-8

5-Bromo-1H-pyrrolo[3,2-b]pyridine-3-carboxaldehyde

Description:

5-Bromo-1H-pyrrolo[3,2-b]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 5-position enhances its reactivity, making it useful in various synthetic applications. The aldehyde functional group at the 3-position is particularly significant, as it can participate in various chemical reactions, including condensation and oxidation. This compound is often utilized in medicinal chemistry and material science due to its potential biological activity and ability to serve as a building block for more complex molecules. Its structural features allow for interactions with biological targets, making it of interest in drug discovery. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important considerations for its practical applications. Overall, 5-Bromo-1H-pyrrolo[3,2-b]pyridine-3-carboxaldehyde is a versatile compound with significant implications in chemical research and development.

Formula: C₈H₅BrN₂O

InChI: InChI=1S/C8H5BrN2O/c9-7-2-1-6-8(11-7)5(4-12)3-10-6/h1-4,10H

InChI key: InChIKey=PUIOZFSCPRTSQS-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(NC1)=CC=C(Br)N2

Synonyms:

• 5-Bromo-1H-pyrrolo[3,2-b]pyridine-3-carboxaldehyde
• 1H-Pyrrolo[3,2-b]pyridine-3-carboxaldehyde, 5-bromo-

1H-Pyrrolo[3,2-b]pyridine-3-carboxaldehyde, 5-bromo-

CAS: 1190317-82-8

Formula: C₈H₅BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 225.0421

Ref: IN-DA000HS7

5-Bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde

CAS: 1190317-82-8

5-Bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde

Purity: 98%

Molecular weight: 225.04g/mol

Ref: 54-OR1059933