CAS 1190317-85-1

3-Bromo-6-chloro-1H-pyrrolo[3,2-b]pyridine

Description:

3-Bromo-6-chloro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 3 and 6 positions, respectively, enhances its reactivity and potential for further chemical modifications. This compound typically exhibits a planar structure, which is conducive to π-π stacking interactions, making it of interest in various applications, including medicinal chemistry and material science. Its heteroatoms can participate in hydrogen bonding and coordination with metal ions, influencing its solubility and reactivity in different solvents. Additionally, the compound may exhibit biological activity, making it a candidate for drug development or as a lead compound in the synthesis of more complex molecules. The specific physical properties, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is measured. Overall, 3-Bromo-6-chloro-1H-pyrrolo[3,2-b]pyridine is a versatile compound with significant potential in various chemical and pharmaceutical applications.

Formula: C₇H₄BrClN₂

InChI: InChI=1S/C7H4BrClN2/c8-5-3-10-6-1-4(9)2-11-7(5)6/h1-3,10H

InChI key: InChIKey=PCNBZQBBFVMANE-UHFFFAOYSA-N

SMILES: BrC=1C=2C(NC1)=CC(Cl)=CN2

Synonyms:

• 3-Bromo-6-chloro-4-azaindole
• 1H-Pyrrolo[3,2-b]pyridine, 3-bromo-6-chloro-
• 3-Bromo-6-chloro-1H-pyrrolo[3,2-b]pyridine

1H-Pyrrolo[3,2-b]pyridine, 3-bromo-6-chloro-

CAS: 1190317-85-1

Formula: C₇H₄BrClN₂

Purity: 97%

Molecular weight: 231.4771

Ref: IN-DA000HS6

3-Bromo-6-chloro-1H-pyrrolo[3,2-b]pyridine

CAS: 1190317-85-1

Purity: 97%

Molecular weight: 231.4799957

Ref: 10-F612147