
CAS 1190317-95-3
:3,6-Dichloro-1H-pyrrolo[3,2-b]pyridine
Description:
3,6-Dichloro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of two chlorine atoms at the 3 and 6 positions enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish color and has a relatively high melting point, indicative of its stable structure. It is often utilized in medicinal chemistry and pharmaceutical research due to its potential biological activity, particularly as a scaffold for drug development. The compound's molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its chlorine substituents can influence its electronic properties, potentially affecting its interactions with biological targets. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 3,6-Dichloro-1H-pyrrolo[3,2-b]pyridine is a significant compound in the field of organic chemistry with promising applications.
Formula:C7H4Cl2N2
InChI:InChI=1S/C7H4Cl2N2/c8-4-1-6-7(11-2-4)5(9)3-10-6/h1-3,10H
InChI key:InChIKey=MYEHHYMJOLYOEC-UHFFFAOYSA-N
SMILES:ClC=1C=2C(NC1)=CC(Cl)=CN2
Synonyms:- 3,6-Dichloro-1H-pyrrolo[3,2-b]pyridine
- 1H-Pyrrolo[3,2-b]pyridine, 3,6-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
