CAS 1190317-98-6

7-Chloro-1H-pyrrolo[2,3-c]pyridin-3-amine

Description:

7-Chloro-1H-pyrrolo[2,3-c]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes both pyrrole and pyridine rings. The presence of a chlorine atom at the 7-position and an amino group at the 3-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound may also display interesting properties such as fluorescence or specific interactions with biological macromolecules, making it a candidate for further research in drug discovery and development. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₇H₆ClN₃

InChI: InChI=1S/C7H6ClN3/c8-7-6-4(1-2-10-7)5(9)3-11-6/h1-3,11H,9H2

InChI key: InChIKey=ZBEFEIUZLALVGC-UHFFFAOYSA-N

SMILES: ClC1=C2C(C(N)=CN2)=CC=N1

Synonyms:

• 7-Chloro-1H-pyrrolo[2,3-c]pyridin-3-amine
• 1H-Pyrrolo[2,3-c]pyridin-3-amine, 7-chloro-

1H-Pyrrolo[2,3-c]pyridin-3-amine, 7-chloro-

CAS: 1190317-98-6

Formula: C₇H₆ClN₃

Molecular weight: 167.5956

Ref: IN-DA000HS1