
CAS 1190318-01-4
:4-Nitro-1H-pyrrolo[2,3-b]pyridin-5-ol
Description:
4-Nitro-1H-pyrrolo[2,3-b]pyridin-5-ol is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a nitro group (-NO2) at the 4-position and a hydroxyl group (-OH) at the 5-position enhances its reactivity and solubility in polar solvents. This compound typically exhibits a pale yellow to brownish color and may have a crystalline or powdery appearance. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The compound's structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, its molecular weight and specific functional groups make it a candidate for further research in areas such as drug design and synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H5N3O3
InChI:InChI=1S/C7H5N3O3/c11-5-3-9-7-4(1-2-8-7)6(5)10(12)13/h1-3,11H,(H,8,9)
InChI key:InChIKey=NGWVNUXLIKFJBM-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=NC=C1O)NC=C2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-nitro-
- 4-Nitro-1H-pyrrolo[2,3-b]pyridin-5-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
