CymitQuimica logo

CAS 1190318-07-0

:

2-Methyl-1H-pyrrolo[3,2-b]pyridin-6-ol

Description:
2-Methyl-1H-pyrrolo[3,2-b]pyridin-6-ol is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a hydroxyl group (-OH) at the 6-position enhances its potential for hydrogen bonding and increases its polarity, making it soluble in polar solvents. The methyl group at the 2-position introduces steric effects that can influence its reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties, as many derivatives of pyrrolopyridines are known for their activity in medicinal chemistry, including anti-inflammatory and anticancer effects. Its structural features suggest potential applications in drug development, particularly in the design of small molecules that can interact with specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 2-Methyl-1H-pyrrolo[3,2-b]pyridin-6-ol represents a valuable scaffold for further research and development in various chemical and pharmaceutical applications.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-5-2-7-8(10-5)3-6(11)4-9-7/h2-4,10-11H,1H3
InChI key:InChIKey=HZLASSGSEVXPCE-UHFFFAOYSA-N
SMILES:CC1=CC=2C(N1)=CC(O)=CN2
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridin-6-ol, 2-methyl-
  • 2-Methyl-1H-pyrrolo[3,2-b]pyridin-6-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.