
CAS 1190318-29-6
:3-Nitro-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile
Description:
3-Nitro-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyridine and pyrrole rings. The presence of a nitro group at the 3-position and a cyano group at the 5-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential for interactions with biological targets, making it of interest in drug discovery and development. The presence of the nitro and cyano functional groups can influence its electronic properties, potentially affecting its biological activity. Additionally, the compound may undergo various chemical reactions, such as nucleophilic substitutions or reductions, depending on the reaction conditions. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive to heat and shock. Overall, 3-Nitro-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile represents a valuable scaffold for further research in organic and medicinal chemistry.
Formula:C8H4N4O2
InChI:InChI=1S/C8H4N4O2/c9-3-5-1-2-6-8(11-5)7(4-10-6)12(13)14/h1-2,4,10H
InChI key:InChIKey=XEDHZYVTCKNIGP-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=CC=C(C#N)N2
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine-5-carbonitrile, 3-nitro-
- 3-Nitro-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
