CAS 1190318-32-1

7-Chloro-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one

Description:

7-Chloro-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 7-position enhances its reactivity and potential biological activity. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents, reflecting its polar functional groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrrolopyridine framework, which is often associated with various biological activities. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, owing to the electron-withdrawing nature of the chlorine substituent. Additionally, its stability and reactivity can be influenced by the presence of functional groups and the overall electronic environment of the molecule. As with many heterocycles, it may exhibit interesting optical and electronic properties, making it a subject of interest in materials science as well.

Formula: C₇H₅ClN₂O

InChI: InChI=1S/C7H5ClN2O/c8-4-1-2-9-5-3-6(11)10-7(4)5/h1-2H,3H2,(H,10,11)

InChI key: InChIKey=UABWTZSJVGFPPS-UHFFFAOYSA-N

SMILES: ClC1=C2C(CC(=O)N2)=NC=C1

Synonyms:

• 2H-Pyrrolo[3,2-b]pyridin-2-one, 7-chloro-1,3-dihydro-
• 7-Chloro-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one

2H-Pyrrolo[3,2-b]pyridin-2-one, 7-chloro-1,3-dihydro-

CAS: 1190318-32-1

Formula: C₇H₅ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.5804

Ref: IN-DA000P58

7-CHLORO-1,3-DIHYDROPYRROLO[3,2-B]PYRIDIN-2-ONE

CAS: 1190318-32-1

Purity: 97%

Molecular weight: 168.5800018

Ref: 10-F818380