CymitQuimica logo

CAS 1190318-36-5

:

3-Nitro-1H-pyrrolo[3,2-b]pyridin-6-ol

Description:
3-Nitro-1H-pyrrolo[3,2-b]pyridin-6-ol is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a nitro group at the 3-position and a hydroxyl group at the 6-position enhances its reactivity and potential for hydrogen bonding. This compound typically exhibits moderate solubility in polar solvents due to the hydroxyl group, while its aromatic nature may impart some degree of stability. The nitro group can participate in electrophilic substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological or chemical activities would require further investigation. Overall, 3-Nitro-1H-pyrrolo[3,2-b]pyridin-6-ol is notable for its complex structure and potential utility in various chemical contexts.
Formula:C7H5N3O3
InChI:InChI=1S/C7H5N3O3/c11-4-1-5-7(9-2-4)6(3-8-5)10(12)13/h1-3,8,11H
InChI key:InChIKey=NUXGLZKFYWBJLT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=CC(O)=CN2
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridin-6-ol, 3-nitro-
  • 3-Nitro-1H-pyrrolo[3,2-b]pyridin-6-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.