CAS 1190318-37-6

7-Bromo-1H-pyrrolo[3,2-b]pyridin-3-amine

Description:

7-Bromo-1H-pyrrolo[3,2-b]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. The presence of a bromine atom at the 7-position and an amino group at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, making it of interest in drug discovery and development. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the presence of the amino group and the bromine atom. As with many heterocycles, its properties can be influenced by substituents and the electronic environment, making it a versatile scaffold for further chemical modifications. Safety and handling precautions should be observed, as with all chemical substances, particularly those containing halogens.

Formula: C₇H₆BrN₃

InChI: InChI=1S/C7H6BrN3/c8-4-1-2-10-7-5(9)3-11-6(4)7/h1-3,11H,9H2

InChI key: InChIKey=XWFYMQKSBWNACM-UHFFFAOYSA-N

SMILES: BrC1=C2C(C(N)=CN2)=NC=C1

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridin-3-amine, 7-bromo-
• 7-Bromo-1H-pyrrolo[3,2-b]pyridin-3-amine

1H-Pyrrolo[3,2-b]pyridin-3-amine, 7-bromo-

CAS: 1190318-37-6

Formula: C₇H₆BrN₃

Molecular weight: 212.0466

Ref: IN-DA000HST