CAS 1190318-41-2

1H-Pyrrolo[3,2-b]pyridine, 3-bromo-7-chloro-

Description:

1H-Pyrrolo[3,2-b]pyridine, 3-bromo-7-chloro- is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 3 and 7 positions, respectively, enhances its reactivity and potential for various chemical transformations. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its aromatic structure. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as heterocycles are often found in biologically active compounds. The compound may also exhibit interesting electronic properties due to the presence of halogen atoms, which can influence its reactivity and interaction with biological targets. Safety and handling precautions should be observed, as halogenated compounds can pose health risks. Overall, 1H-Pyrrolo[3,2-b]pyridine, 3-bromo-7-chloro- is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₇H₄BrClN₂

InChI: InChI=1S/C7H4BrClN2/c8-4-3-11-7-5(9)1-2-10-6(4)7/h1-3,11H

InChI key: InChIKey=RSWACOURMIZDLI-UHFFFAOYSA-N

SMILES: ClC1=C2C(C(Br)=CN2)=NC=C1

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine, 3-bromo-7-chloro-
• 3-Bromo-7-chloro-1H-pyrrolo[3,2-b]pyridine

1H-Pyrrolo[3,2-b]pyridine, 3-bromo-7-chloro-

CAS: 1190318-41-2

Formula: C₇H₄BrClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 231.4771

Ref: IN-DA000HSR

3-Bromo-7-chloro-1H-pyrrolo[3,2-b]pyridine

CAS: 1190318-41-2

3-Bromo-7-chloro-1H-pyrrolo[3,2-b]pyridine

Purity: 95%

Molecular weight: 231.48g/mol

Ref: 54-OR1045371

3-Bromo-7-chloro-1H-pyrrolo[3,2-b]pyridine

CAS: 1190318-41-2

Versatile small molecule scaffold

Formula: C₇H₄BrClN₂

Purity: Min. 95%

Molecular weight: 231.48 g/mol

Ref: 3D-QXB31841