CAS 1190318-42-3

7-Cyano-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid

Description:

7-Cyano-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures. This compound features a cyano group (-CN) and a carboxylic acid group (-COOH), which contribute to its chemical reactivity and potential biological activity. The presence of the cyano group can enhance the compound's ability to participate in nucleophilic reactions, while the carboxylic acid group can engage in hydrogen bonding and influence solubility in polar solvents. The unique bicyclic structure of this compound may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, its molecular framework allows for various functionalization possibilities, which can be explored for the development of novel therapeutic agents. The compound's CAS number, 1190318-42-3, serves as a unique identifier for regulatory and research purposes, facilitating its study in various chemical and biological contexts. Overall, 7-Cyano-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid represents a versatile scaffold for further chemical exploration.

Formula: C₉H₅N₃O₂

InChI: InChI=1S/C9H5N3O2/c10-3-7-8-5(1-2-11-7)6(4-12-8)9(13)14/h1-2,4,12H,(H,13,14)

InChI key: InChIKey=KAKIUESKSZKOAO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(=C(C#N)N=CC2)NC1

Synonyms:

• 1H-Pyrrolo[2,3-c]pyridine-3-carboxylic acid, 7-cyano-
• 7-Cyano-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid

1H-Pyrrolo[2,3-c]pyridine-3-carboxylic acid, 7-cyano-

CAS: 1190318-42-3

Formula: C₉H₅N₃O₂

Molecular weight: 187.1549

Ref: IN-DA000HSQ