CAS 1190318-46-7

3,7-Dibromo-1H-pyrrolo[3,2-b]pyridine

Description:

3,7-Dibromo-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine substituents at the 3 and 7 positions enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry and material science. This compound typically exhibits moderate solubility in organic solvents, and its structure can facilitate various chemical reactions, including electrophilic substitutions and cross-coupling reactions. The bromine atoms can serve as leaving groups or participate in further functionalization, allowing for the synthesis of more complex derivatives. Additionally, the compound's heteroatom content may impart specific electronic properties, potentially affecting its interaction with biological targets. Overall, 3,7-Dibromo-1H-pyrrolo[3,2-b]pyridine is a versatile building block in organic synthesis, with applications in drug development and the creation of novel materials.

Formula: C₇H₄Br₂N₂

InChI: InChI=1S/C7H4Br2N2/c8-4-1-2-10-7-5(9)3-11-6(4)7/h1-3,11H

InChI key: InChIKey=AACMYUTVEHPBSH-UHFFFAOYSA-N

SMILES: BrC1=C2C(C(Br)=CN2)=NC=C1

Synonyms:

• 3,7-Dibromo-1H-pyrrolo[3,2-b]pyridine
• 1H-Pyrrolo[3,2-b]pyridine, 3,7-dibromo-

1H-Pyrrolo[3,2-b]pyridine, 3,7-dibromo-

CAS: 1190318-46-7

Formula: C₇H₄Br₂N₂

Molecular weight: 275.9281

Ref: IN-DA000HSO