CymitQuimica logo

CAS 1190318-47-8

:

5-Methyl-3-nitro-1H-pyrrolo[3,2-b]pyridine

Description:
5-Methyl-3-nitro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of a methyl group and a nitro group at specific positions on the ring system influences its reactivity and potential applications. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its aromatic structure. The nitro group is known for its electron-withdrawing properties, which can affect the compound's acidity and reactivity in electrophilic substitution reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, which could be explored in pharmacological studies. Overall, 5-Methyl-3-nitro-1H-pyrrolo[3,2-b]pyridine represents a class of compounds that can be valuable in various chemical and pharmaceutical applications.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-5-2-3-6-8(10-5)7(4-9-6)11(12)13/h2-4,9H,1H3
InChI key:InChIKey=FQSPZLWPYKAYLX-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=CC=C(C)N2
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridine, 5-methyl-3-nitro-
  • 5-Methyl-3-nitro-1H-pyrrolo[3,2-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.