CymitQuimica logo

CAS 1190318-54-7

:

3-Bromo-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile

Description:
3-Bromo-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrole and pyridine moiety. The presence of a bromine atom at the 3-position and a cyano group at the 7-position contributes to its reactivity and potential applications in medicinal chemistry and material science. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in the synthesis of pharmaceuticals or agrochemicals. The presence of the cyano group also indicates potential for further functionalization, enhancing its utility in synthetic pathways. Additionally, the compound's unique electronic properties, influenced by the heteroatoms and substituents, may impart interesting biological activities, warranting further investigation in drug discovery contexts. Overall, 3-Bromo-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile is a compound of interest due to its structural features and potential applications.
Formula:C8H4BrN3
InChI:InChI=1S/C8H4BrN3/c9-6-4-12-8-5(6)1-2-11-7(8)3-10/h1-2,4,12H
InChI key:InChIKey=OSKDHDYEPIIDNC-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(C(Br)=CN2)=CC=N1
Synonyms:
  • 3-Bromo-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile
  • 1H-Pyrrolo[2,3-c]pyridine-7-carbonitrile, 3-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.