CymitQuimica logo

CAS 1190318-61-6

:

7-Bromo-3-nitro-1H-pyrrolo[3,2-b]pyridine

Description:
7-Bromo-3-nitro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 7-position and a nitro group at the 3-position enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate solubility in organic solvents, and its structure may influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The nitro group can serve as a functional handle for further chemical modifications, while the bromine atom can facilitate cross-coupling reactions. Additionally, the compound may exhibit biological activity, making it of interest in drug discovery and development. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and can vary based on purity and environmental conditions.
Formula:C7H4BrN3O2
InChI:InChI=1S/C7H4BrN3O2/c8-4-1-2-9-7-5(11(12)13)3-10-6(4)7/h1-3,10H
InChI key:InChIKey=KOHZOOVPZQCNSU-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=C(Br)C=CN2
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridine, 7-bromo-3-nitro-
  • 7-Bromo-3-nitro-1H-pyrrolo[3,2-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.