
CAS 1190318-65-0
:Methyl 3-amino-1H-pyrrolo[3,2-b]pyridine-5-carboxylate
Description:
Methyl 3-amino-1H-pyrrolo[3,2-b]pyridine-5-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which features a fused pyrrole and pyridine ring system. This compound typically exhibits properties associated with nitrogen-containing heterocycles, such as potential basicity due to the presence of amino and pyridine nitrogen atoms. It is likely to be a solid at room temperature, with moderate solubility in polar organic solvents due to the presence of the carboxylate group. The methyl ester functional group contributes to its reactivity, making it a potential candidate for further chemical modifications or as an intermediate in synthetic pathways. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases for precise values. Overall, Methyl 3-amino-1H-pyrrolo[3,2-b]pyridine-5-carboxylate represents a versatile structure in organic synthesis and pharmaceutical research.
Formula:C9H9N3O2
InChI:InChI=1S/C9H9N3O2/c1-14-9(13)7-3-2-6-8(12-7)5(10)4-11-6/h2-4,11H,10H2,1H3
InChI key:InChIKey=QLOQIZGKQQUHFE-UHFFFAOYSA-N
SMILES:NC=1C=2C(=CC=C(C(OC)=O)N2)NC1
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine-5-carboxylic acid, 3-amino-, methyl ester
- Methyl 3-amino-1H-pyrrolo[3,2-b]pyridine-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrrolo[3,2-b]pyridine-5-carboxylic acid, 3-amino-, methyl ester
CAS:Formula:C9H9N3O2Molecular weight:191.1867
