CAS 1190318-73-0

4-Chloro-1H-pyrrolo[3,2-c]pyridin-3-amine

Description:

4-Chloro-1H-pyrrolo[3,2-c]pyridin-3-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position and an amino group at the 3-position enhances its reactivity and potential for forming various derivatives. This compound is typically a solid at room temperature and is soluble in polar organic solvents, making it suitable for various synthetic applications. Its structure suggests potential biological activity, which has led to interest in its use in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's molecular framework allows for interactions with biological targets, making it a candidate for further research in drug discovery. Additionally, its stability under standard laboratory conditions and the ability to undergo various chemical reactions, such as substitution and coupling, make it a valuable intermediate in organic synthesis.

Formula: C₇H₆ClN₃

InChI: InChI=1S/C7H6ClN3/c8-7-6-4(9)3-11-5(6)1-2-10-7/h1-3,11H,9H2

InChI key: InChIKey=AQQYZVBSUPFRQC-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC=N1)NC=C2N

Synonyms:

• 1H-Pyrrolo[3,2-c]pyridin-3-amine, 4-chloro-
• 4-Chloro-1H-pyrrolo[3,2-c]pyridin-3-amine

1H-Pyrrolo[3,2-c]pyridin-3-amine, 4-chloro-

CAS: 1190318-73-0

Formula: C₇H₆ClN₃

Molecular weight: 167.5956

Ref: IN-DA000HTM