
CAS 1190318-74-1
:2,3-Dihydro-2-oxo-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid
Description:
2,3-Dihydro-2-oxo-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which includes a pyrrolidine and a pyridine ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a carbonyl group (ketone) in the pyrrolidine ring enhances its reactivity, making it a potential candidate for various chemical transformations. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. The compound's structure suggests potential biological activity, which could be explored in medicinal chemistry. Its specific applications may include roles in drug development or as intermediates in organic synthesis. As with many heterocycles, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be influenced by its molecular interactions and substituents. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C8H6N2O3
InChI:InChI=1S/C8H6N2O3/c11-7-2-5-6(10-7)1-4(3-9-5)8(12)13/h1,3H,2H2,(H,10,11)(H,12,13)
InChI key:InChIKey=CGYZCBDNBHYSSU-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2C(=NC1)CC(=O)N2
Synonyms:- 2,3-Dihydro-2-oxo-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid
- 1H-Pyrrolo[3,2-b]pyridine-6-carboxylic acid, 2,3-dihydro-2-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.