CymitQuimica logo

CAS 1190318-76-3

:

4,6-Difluoro-1H-pyrrolo[2,3-b]pyridine

Description:
4,6-Difluoro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of two fluorine atoms at the 4 and 6 positions enhances its reactivity and influences its electronic properties, making it a valuable intermediate in medicinal chemistry and material science. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. Its molecular structure allows for potential applications in drug development, particularly in the synthesis of biologically active molecules. The fluorine substituents can improve metabolic stability and bioavailability, which are critical factors in pharmaceutical design. Additionally, the compound may exhibit interesting optical and electronic properties, making it a candidate for use in organic electronics or as a fluorescent probe. As with many fluorinated compounds, handling should be done with care due to potential toxicity and environmental concerns.
Formula:C7H4F2N2
InChI:InChI=1S/C7H4F2N2/c8-5-3-6(9)11-7-4(5)1-2-10-7/h1-3H,(H,10,11)
InChI key:InChIKey=LCEPIOOFFZSNRO-UHFFFAOYSA-N
SMILES:FC1=C2C(=NC(F)=C1)NC=C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 4,6-difluoro-
  • 4,6-Difluoro-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.