
CAS 1190318-88-7
:1H-Pyrrolo[2,3-c]pyridine-3,7-dicarboxylic acid
Description:
1H-Pyrrolo[2,3-c]pyridine-3,7-dicarboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features two carboxylic acid functional groups located at the 3 and 7 positions of the pyrrolo-pyridine structure, enhancing its potential for hydrogen bonding and reactivity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid groups. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets through its aromatic system and functional groups. Additionally, its unique bicyclic framework may impart interesting electronic properties, making it a candidate for further research in organic synthesis and material science. As with many heterocycles, the stability and reactivity of this compound can be influenced by substituents and environmental conditions, warranting careful consideration in experimental applications.
Formula:C9H6N2O4
InChI:InChI=1S/C9H6N2O4/c12-8(13)5-3-11-6-4(5)1-2-10-7(6)9(14)15/h1-3,11H,(H,12,13)(H,14,15)
InChI key:InChIKey=LGRYUOLAMKMBCL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(C(C(O)=O)=CN2)=CC=N1
Synonyms:- 1H-Pyrrolo[2,3-c]pyridine-3,7-dicarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
