
CAS 1190318-96-7
:1H-Pyrrolo[3,2-b]pyridin-7-ol
Description:
1H-Pyrrolo[3,2-b]pyridin-7-ol is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a hydroxyl (-OH) group at the 7-position of the pyridine ring, enhancing its potential for hydrogen bonding and reactivity. It typically exhibits moderate solubility in polar solvents due to the presence of the hydroxyl group, while its aromatic structure provides stability and potential for π-π interactions. The compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it of interest in medicinal chemistry and organic synthesis. Its structural features suggest potential biological activity, which could be explored in drug development. Additionally, the compound's specific properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods, contributing to its identification and application in research. Overall, 1H-Pyrrolo[3,2-b]pyridin-7-ol represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c10-6-2-4-8-5-1-3-9-7(5)6/h1-4,9H,(H,8,10)
InChI key:InChIKey=PDPLYIVUXGYZPZ-UHFFFAOYSA-N
SMILES:OC1=C2C(=NC=C1)C=CN2
Synonyms:- 1H-Pyrrolo[3,2-b]pyridin-7-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
