CAS 1190319-02-8

3-Chloro-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile

Description:

3-Chloro-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. The presence of a chlorine atom at the 3-position and a cyano group at the 7-position contributes to its chemical reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery and development. The cyano group can participate in nucleophilic reactions, while the chlorine atom may serve as a leaving group in various synthetic pathways. Additionally, the compound's heteroatoms can influence its electronic properties, potentially affecting its pharmacokinetics and pharmacodynamics. Overall, 3-Chloro-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile is a compound of interest for further research in the fields of organic synthesis and pharmaceutical chemistry.

Formula: C₈H₄ClN₃

InChI: InChI=1S/C8H4ClN3/c9-6-4-12-7-5(3-10)1-2-11-8(6)7/h1-2,4,12H

InChI key: InChIKey=YECATBGONZJMNT-UHFFFAOYSA-N

SMILES: C(#N)C1=C2C(C(Cl)=CN2)=NC=C1

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-7-carbonitrile, 3-chloro-
• 3-Chloro-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile

1H-Pyrrolo[3,2-b]pyridine-7-carbonitrile, 3-chloro-

CAS: 1190319-02-8

Formula: C₈H₄ClN₃

Molecular weight: 177.5905

Ref: IN-DA000HU5