CAS 1190319-06-2

4-Methyl-3-nitro-1H-pyrrolo[2,3-c]pyridine

Description:

4-Methyl-3-nitro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine and a pyrrole ring. This compound features a methyl group at the 4-position and a nitro group at the 3-position, contributing to its chemical reactivity and potential applications in medicinal chemistry. The presence of the nitro group typically enhances the compound's electrophilic properties, making it a candidate for further chemical modifications. It is generally soluble in organic solvents, and its stability can vary depending on environmental conditions such as temperature and pH. The compound may exhibit biological activity, which is of interest in drug development, particularly in targeting specific biological pathways. As with many nitro-containing compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 4-Methyl-3-nitro-1H-pyrrolo[2,3-c]pyridine represents a valuable structure for further research in organic synthesis and pharmacology.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c1-5-2-9-3-6-8(5)7(4-10-6)11(12)13/h2-4,10H,1H3

InChI key: InChIKey=AGQXSMXSSDORNO-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=2C(NC1)=CN=CC2C

Synonyms:

• 4-Methyl-3-nitro-1H-pyrrolo[2,3-c]pyridine
• 1H-Pyrrolo[2,3-c]pyridine, 4-methyl-3-nitro-

1H-Pyrrolo[2,3-c]pyridine, 4-methyl-3-nitro-

CAS: 1190319-06-2

Formula: C₈H₇N₃O₂

Molecular weight: 177.1601

Ref: IN-DA000HU1