CAS 1190319-07-3
:7-Bromo-3-iodo-1H-pyrrolo[3,2-b]pyridine
Description:
7-Bromo-3-iodo-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and iodine substituents at the 7 and 3 positions, respectively, enhances its reactivity and potential for further chemical modifications. This compound typically exhibits a planar structure, which can facilitate π-π stacking interactions, making it of interest in materials science and medicinal chemistry. Its halogenated nature may also impart interesting electronic properties, potentially influencing its behavior in biological systems or as a ligand in coordination chemistry. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are crucial for its application in synthetic pathways or as a pharmaceutical agent. Overall, 7-Bromo-3-iodo-1H-pyrrolo[3,2-b]pyridine represents a versatile scaffold for further chemical exploration and development.
Formula:C7H4BrIN2
InChI:InChI=1S/C7H4BrIN2/c8-4-1-2-10-7-5(9)3-11-6(4)7/h1-3,11H
InChI key:InChIKey=FLEOBAJJCXKANA-UHFFFAOYSA-N
SMILES:BrC1=C2C(C(I)=CN2)=NC=C1
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine, 7-bromo-3-iodo-
- 7-Bromo-3-iodo-1H-pyrrolo[3,2-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
