CAS 1190319-11-9

3-Bromo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile

Description:

3-Bromo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine and a pyrrole moiety. The presence of a bromine atom at the 3-position and a cyano group at the 7-position contributes to its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The cyano group can participate in nucleophilic reactions, while the bromine atom can serve as a leaving group in substitution reactions. Overall, 3-Bromo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile is of interest for its potential biological activity and utility in synthetic organic chemistry.

Formula: C₈H₄BrN₃

InChI: InChI=1S/C8H4BrN3/c9-6-4-12-7-5(3-10)1-2-11-8(6)7/h1-2,4,12H

InChI key: InChIKey=SQLXNOWCFBCIMO-UHFFFAOYSA-N

SMILES: C(#N)C1=C2C(C(Br)=CN2)=NC=C1

Synonyms:

• 3-Bromo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile
• 1H-Pyrrolo[3,2-b]pyridine-7-carbonitrile, 3-bromo-

1H-Pyrrolo[3,2-b]pyridine-7-carbonitrile, 3-bromo-

CAS: 1190319-11-9

Formula: C₈H₄BrN₃

Molecular weight: 222.0415

Ref: IN-DA000HTY