
CAS 1190319-12-0
:3-Chloro-1H-pyrrolo[2,3-c]pyridin-4-amine
Description:
3-Chloro-1H-pyrrolo[2,3-c]pyridin-4-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. The presence of a chlorine atom at the 3-position and an amino group at the 4-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, while its aromatic nature can influence its interactions with other molecules. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and material science. The compound's specific properties, such as melting point, boiling point, and spectral characteristics, would depend on its purity and the conditions under which it is studied. Additionally, its potential applications could include roles as intermediates in drug synthesis or as building blocks in the development of novel pharmaceuticals.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c8-4-1-11-6-3-10-2-5(9)7(4)6/h1-3,11H,9H2
InChI key:InChIKey=UOEHFRBUMSNZNC-UHFFFAOYSA-N
SMILES:NC1=C2C(=CN=C1)NC=C2Cl
Synonyms:- 1H-Pyrrolo[2,3-c]pyridin-4-amine, 3-chloro-
- 3-Chloro-1H-pyrrolo[2,3-c]pyridin-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
