CymitQuimica logo

CAS 1190319-19-7

:

7-Methyl-3-nitro-1H-pyrrolo[3,2-b]pyridine

Description:
7-Methyl-3-nitro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of a methyl group at the 7-position and a nitro group at the 3-position enhances its reactivity and potential biological activity. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The nitro group can participate in electrophilic substitution reactions, while the nitrogen atoms in the ring can engage in hydrogen bonding, influencing its behavior in biological systems. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature. Overall, 7-Methyl-3-nitro-1H-pyrrolo[3,2-b]pyridine is a compound of interest for further research in synthetic and medicinal chemistry.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-5-2-3-9-8-6(11(12)13)4-10-7(5)8/h2-4,10H,1H3
InChI key:InChIKey=FDDPCNDFXIVSRY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=C(C)C=CN2
Synonyms:
  • 7-Methyl-3-nitro-1H-pyrrolo[3,2-b]pyridine
  • 1H-Pyrrolo[3,2-b]pyridine, 7-methyl-3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.