CAS 1190319-22-2

1H-Pyrrolo[3,2-b]pyridine-3,7-dicarboxylic acid

Description:

1H-Pyrrolo[3,2-b]pyridine-3,7-dicarboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features two carboxylic acid functional groups located at the 3 and 7 positions of the pyrrolo-pyridine structure, enhancing its potential for forming hydrogen bonds and participating in various chemical reactions. The presence of these carboxylic acid groups also suggests that the compound may exhibit acidic behavior, making it soluble in polar solvents. Its structural configuration allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with heterocyclic compounds. Additionally, the compound may serve as a building block in organic synthesis or as a ligand in coordination chemistry. Overall, 1H-Pyrrolo[3,2-b]pyridine-3,7-dicarboxylic acid is notable for its complex structure and potential utility in various chemical and biological applications.

Formula: C₉H₆N₂O₄

InChI: InChI=1S/C9H6N2O4/c12-8(13)4-1-2-10-7-5(9(14)15)3-11-6(4)7/h1-3,11H,(H,12,13)(H,14,15)

InChI key: InChIKey=ZBTGXRQGIIKURY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(C(C(O)=O)=CN2)=NC=C1

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-3,7-dicarboxylic acid

1H-Pyrrolo[3,2-b]pyridine-3,7-dicarboxylic acid

CAS: 1190319-22-2

Formula: C₉H₆N₂O₄

Molecular weight: 206.1549

Ref: IN-DA000HTQ