CAS 1190319-23-3

5-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid

Description:

5-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. This compound features a methoxy group (-OCH3) and a carboxylic acid group (-COOH), which enhance its solubility in polar solvents and influence its reactivity. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as they may interact with biological targets. The compound's molecular structure allows for various chemical reactions, including esterification and amidation, which can be utilized in synthetic pathways. Additionally, its heterocyclic nature may impart specific biological activities, making it of interest in research related to neuropharmacology or other therapeutic areas. Overall, 5-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid is a compound with significant potential for further exploration in both synthetic and medicinal chemistry.

Formula: C₉H₈N₂O₃

InChI: InChI=1S/C9H8N2O3/c1-14-7-3-2-6-8(11-7)5(4-10-6)9(12)13/h2-4,10H,1H3,(H,12,13)

InChI key: InChIKey=ABSHGTKCNSLCGZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1)=CC=C(OC)N2

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid, 5-methoxy-
• 5-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid

1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid, 5-methoxy-

CAS: 1190319-23-3

Formula: C₉H₈N₂O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 192.1714

Ref: IN-DA000HTP

5-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid

CAS: 1190319-23-3

5-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid

Purity: 96%

Ref: 54-OR1041135

5-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid

CAS: 1190319-23-3

Purity: 96%

Molecular weight: 192.173996

Ref: 10-F690808