CAS 1190319-25-5

3-Chloro-1H-pyrrolo[3,2-b]pyridin-7-amine

Description:

3-Chloro-1H-pyrrolo[3,2-b]pyridin-7-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. The presence of a chlorine atom at the 3-position and an amino group at the 7-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. It is of interest in medicinal chemistry and drug development, particularly for its potential as a pharmacophore in targeting specific biological pathways. The compound's molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its properties can be influenced by the electronic effects of the chlorine and amino groups, which may affect its interaction with biological targets. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₆ClN₃

InChI: InChI=1S/C7H6ClN3/c8-4-3-11-7-5(9)1-2-10-6(4)7/h1-3,11H,(H2,9,10)

InChI key: InChIKey=NBGNSRDAOOIGJS-UHFFFAOYSA-N

SMILES: NC1=C2C(C(Cl)=CN2)=NC=C1

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridin-7-amine, 3-chloro-
• 3-Chloro-1H-pyrrolo[3,2-b]pyridin-7-amine

1H-Pyrrolo[3,2-b]pyridin-7-amine, 3-chloro-

CAS: 1190319-25-5

Formula: C₇H₆ClN₃

Molecular weight: 167.5956

Ref: IN-DA000HTN