CAS 1190319-28-8

3-Bromo-1H-pyrrolo[3,2-b]pyridin-7-amine

Description:

3-Bromo-1H-pyrrolo[3,2-b]pyridin-7-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 3-position and an amino group at the 7-position enhances its reactivity and potential for forming various derivatives. This compound typically exhibits moderate solubility in polar solvents due to its polar functional groups, while its aromatic nature may impart some degree of stability. It is of interest in medicinal chemistry and drug development, particularly for its potential biological activities, including anti-cancer and anti-inflammatory properties. The compound's structure allows for various substitution reactions, making it a versatile building block in organic synthesis. Additionally, its molecular interactions can be influenced by the presence of the bromine atom, which can participate in electrophilic aromatic substitution reactions. Overall, 3-Bromo-1H-pyrrolo[3,2-b]pyridin-7-amine is a significant compound in the field of organic and medicinal chemistry.

Formula: C₇H₆BrN₃

InChI: InChI=1S/C7H6BrN3/c8-4-3-11-7-5(9)1-2-10-6(4)7/h1-3,11H,(H2,9,10)

InChI key: InChIKey=WLPWGNMIRLETOZ-UHFFFAOYSA-N

SMILES: NC1=C2C(C(Br)=CN2)=NC=C1

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridin-7-amine, 3-bromo-
• 3-Bromo-1H-pyrrolo[3,2-b]pyridin-7-amine

1H-Pyrrolo[3,2-b]pyridin-7-amine, 3-bromo-

CAS: 1190319-28-8

Formula: C₇H₆BrN₃

Molecular weight: 212.0466

Ref: IN-DA000HUZ