CAS 1190319-30-2

4-Bromo-1H-pyrrolo[2,3-c]pyridin-3-amine

Description:

4-Bromo-1H-pyrrolo[2,3-c]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. The presence of a bromine atom at the 4-position of the pyrrole ring contributes to its reactivity and potential applications in medicinal chemistry. This compound features an amino group at the 3-position, which can participate in various chemical reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Its molecular structure allows for potential interactions with biological targets, suggesting possible bioactivity. The compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Bromo-1H-pyrrolo[2,3-c]pyridin-3-amine is of interest in research for its potential applications in drug development and as a building block in organic synthesis.

Formula: C₇H₆BrN₃

InChI: InChI=1S/C7H6BrN3/c8-4-1-10-3-6-7(4)5(9)2-11-6/h1-3,11H,9H2

InChI key: InChIKey=FDRDTBMRKSNFJE-UHFFFAOYSA-N

SMILES: BrC1=C2C(=CN=C1)NC=C2N

Synonyms:

• 1H-Pyrrolo[2,3-c]pyridin-3-amine, 4-bromo-
• 4-Bromo-1H-pyrrolo[2,3-c]pyridin-3-amine

1H-Pyrrolo[2,3-c]pyridin-3-amine, 4-bromo-

CAS: 1190319-30-2

Formula: C₇H₆BrN₃

Molecular weight: 212.0466

Ref: IN-DA000HUX