
CAS 1190319-31-3
:3-Amino-1,4-dihydro-5H-pyrrolo[3,2-b]pyridin-5-one
Description:
3-Amino-1,4-dihydro-5H-pyrrolo[3,2-b]pyridin-5-one is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features an amino group, which enhances its potential for hydrogen bonding and reactivity in various chemical reactions. The presence of the dihydro structure indicates that it has a saturated bond within the ring system, which can influence its stability and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. Overall, 3-Amino-1,4-dihydro-5H-pyrrolo[3,2-b]pyridin-5-one represents a class of compounds that can be explored for various chemical and biological applications.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c8-4-3-9-5-1-2-6(11)10-7(4)5/h1-3,9H,8H2,(H,10,11)
InChI key:InChIKey=OJRAJCMHGNSYGQ-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC(=O)N2)NC1
Synonyms:- 5H-Pyrrolo[3,2-b]pyridin-5-one, 3-amino-1,4-dihydro-
- 3-Amino-1,4-dihydro-5H-pyrrolo[3,2-b]pyridin-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
